About 3-butyl-4-[(3E)-3-ethylidenehept-1-en-2-yl]-2-methyl-2,5-dihydrofuran
3-butyl-4-[(3E)-3-ethylidenehept-1-en-2-yl]-2-methyl-2,5-dihydrofuran (PubChem CID 11832235) has the molecular formula C18H30O
and a molecular weight of 262.44 g/mol. Its IUPAC name is 3-butyl-4-[(3E)-3-ethylidenehept-1-en-2-yl]-2-methyl-2,5-dihydrofuran.
Molecular Properties
| Compound Name | 3-butyl-4-[(3E)-3-ethylidenehept-1-en-2-yl]-2-methyl-2,5-dihydrofuran |
| PubChem CID | 11832235 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | 3-butyl-4-[(3E)-3-ethylidenehept-1-en-2-yl]-2-methyl-2,5-dihydrofuran |
| SMILES | C=C(C1=C(CCCC)C(C)OC1)/C(=C/C)CCCC |
| InChI | InChI=1S/C18H30O/c1-6-9-11-16(8-3)14(4)18-13-19-15(5)17(18)12-10-7-2/h8,15H,4,6-7,9-13H2,1-3,5H3/b16-8+ |
| InChIKey | DRUOBVWSUWNSFR-LZYBPNLTSA-N |
| XLogP | 5.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-butyl-4-[(3E)-3-ethylidenehept-1-en-2-yl]-2-methyl-2,5-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-4-[(3E)-3-ethylidenehept-1-en-2-yl]-2-methyl-2,5-dihydrofuran?
The IUPAC name of 3-butyl-4-[(3E)-3-ethylidenehept-1-en-2-yl]-2-methyl-2,5-dihydrofuran (CID 11832235) is 3-butyl-4-[(3E)-3-ethylidenehept-1-en-2-yl]-2-methyl-2,5-dihydrofuran.
What is the SMILES notation for 3-butyl-4-[(3E)-3-ethylidenehept-1-en-2-yl]-2-methyl-2,5-dihydrofuran?
The canonical SMILES for 3-butyl-4-[(3E)-3-ethylidenehept-1-en-2-yl]-2-methyl-2,5-dihydrofuran is C=C(C1=C(CCCC)C(C)OC1)/C(=C/C)CCCC.
What is the InChIKey of 3-butyl-4-[(3E)-3-ethylidenehept-1-en-2-yl]-2-methyl-2,5-dihydrofuran?
The InChIKey is DRUOBVWSUWNSFR-LZYBPNLTSA-N. The full InChI is InChI=1S/C18H30O/c1-6-9-11-16(8-3)14(4)18-13-19-15(5)17(18)12-10-7-2/h8,15H,4,6-7,9-13H2,1-3,5H3/b16-8+.
What are the key properties of 3-butyl-4-[(3E)-3-ethylidenehept-1-en-2-yl]-2-methyl-2,5-dihydrofuran?
3-butyl-4-[(3E)-3-ethylidenehept-1-en-2-yl]-2-methyl-2,5-dihydrofuran has a molecular weight of 262.44 g/mol, XLogP of 5.58, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-4-[(3E)-3-ethylidenehept-1-en-2-yl]-2-methyl-2,5-dihydrofuran is sourced from PubChem (CID 11832235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).