C27H21F4N9O3 — CID 118322901
5-[2-(5-fluoropyrimidin-2-yl)ethynyl]-1-[2-oxo-2-[(1R,3S,5R)-3-[[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]carbamoyl]-2-azabicyclo[3.1.0]hexan-2-yl]ethyl]indazole-3-carboxamide (PubChem CID 118322901) has the molecular formula C27H21F4N9O3 and a molecular weight of 595.52 g/mol. Its IUPAC name is 5-[2-(5-fluoropyrimidin-2-yl)ethynyl]-1-[2-oxo-2-[(1R,3S,5R)-3-[[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]carbamoyl]-2-azabicyclo[3.1.0]hexan-2-yl]ethyl]indazole-3-carboxamide.
| Compound Name | 5-[2-(5-fluoropyrimidin-2-yl)ethynyl]-1-[2-oxo-2-[(1R,3S,5R)-3-[[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]carbamoyl]-2-azabicyclo[3.1.0]hexan-2-yl]ethyl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 118322901 |
| Molecular Formula | C27H21F4N9O3 |
| Molecular Weight | 595.52 g/mol |
| Exact Mass | 595.17 |
| IUPAC Name | 5-[2-(5-fluoropyrimidin-2-yl)ethynyl]-1-[2-oxo-2-[(1R,3S,5R)-3-[[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]carbamoyl]-2-azabicyclo[3.1.0]hexan-2-yl]ethyl]indazole-3-carboxamide |
| SMILES | NC(=O)c1nn(CC(=O)N2[C@@H]3C[C@@H]3C[C@H]2C(=O)Nc2ccn(CC(F)(F)F)n2)c2ccc(C#Cc3ncc(F)cn3)cc12 |
| InChI | InChI=1S/C27H21F4N9O3/c28-16-10-33-21(34-11-16)4-2-14-1-3-18-17(7-14)24(25(32)42)37-39(18)12-23(41)40-19-8-15(19)9-20(40)26(43)35-22-5-6-38(36-22)13-27(29,30)31/h1,3,5-7,10-11,15,19-20H,8-9,12-13H2,(H2,32,42)(H,35,36,43)/t15-,19-,20+/m1/s1 |
| InChIKey | LLOJSKXZJAGQFY-YSGRDPCXSA-N |
| XLogP | 1.85 |
| TPSA | 153.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.52 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|