C27H21FN8O3 — CID 118322930
1-[2-[(1R,3S,5R)-3-[(6-fluoro-2-pyridinyl)carbamoyl]-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]-5-(2-pyrimidin-2-ylethynyl)indazole-3-carboxamide (PubChem CID 118322930) has the molecular formula C27H21FN8O3 and a molecular weight of 524.52 g/mol. Its IUPAC name is 1-[2-[(1R,3S,5R)-3-[(6-fluoro-2-pyridinyl)carbamoyl]-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]-5-(2-pyrimidin-2-ylethynyl)indazole-3-carboxamide.
| Compound Name | 1-[2-[(1R,3S,5R)-3-[(6-fluoro-2-pyridinyl)carbamoyl]-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]-5-(2-pyrimidin-2-ylethynyl)indazole-3-carboxamide |
|---|---|
| PubChem CID | 118322930 |
| Molecular Formula | C27H21FN8O3 |
| Molecular Weight | 524.52 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | 1-[2-[(1R,3S,5R)-3-[(6-fluoro-2-pyridinyl)carbamoyl]-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]-5-(2-pyrimidin-2-ylethynyl)indazole-3-carboxamide |
| SMILES | NC(=O)c1nn(CC(=O)N2[C@@H]3C[C@@H]3C[C@H]2C(=O)Nc2cccc(F)n2)c2ccc(C#Cc3ncccn3)cc12 |
| InChI | InChI=1S/C27H21FN8O3/c28-21-3-1-4-23(32-21)33-27(39)20-13-16-12-19(16)36(20)24(37)14-35-18-7-5-15(6-8-22-30-9-2-10-31-22)11-17(18)25(34-35)26(29)38/h1-5,7,9-11,16,19-20H,12-14H2,(H2,29,38)(H,32,33,39)/t16-,19-,20+/m1/s1 |
| InChIKey | MAVXBTQTNFTMQE-AHRSYUTCSA-N |
| XLogP | 1.49 |
| TPSA | 148.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.52 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|