C32H27FN8O3 — CID 118322972
1-[2-[(2S,4R)-4-fluoro-2-(1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl)pyrrolidin-1-yl]-2-oxoethyl]-5-(2-pyrimidin-2-ylethynyl)indazole-3-carboxamide (PubChem CID 118322972) has the molecular formula C32H27FN8O3 and a molecular weight of 590.62 g/mol. Its IUPAC name is 1-[2-[(2S,4R)-4-fluoro-2-(1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl)pyrrolidin-1-yl]-2-oxoethyl]-5-(2-pyrimidin-2-ylethynyl)indazole-3-carboxamide.
| Compound Name | 1-[2-[(2S,4R)-4-fluoro-2-(1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl)pyrrolidin-1-yl]-2-oxoethyl]-5-(2-pyrimidin-2-ylethynyl)indazole-3-carboxamide |
|---|---|
| PubChem CID | 118322972 |
| Molecular Formula | C32H27FN8O3 |
| Molecular Weight | 590.62 g/mol |
| Exact Mass | 590.22 |
| IUPAC Name | 1-[2-[(2S,4R)-4-fluoro-2-(1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl)pyrrolidin-1-yl]-2-oxoethyl]-5-(2-pyrimidin-2-ylethynyl)indazole-3-carboxamide |
| SMILES | NC(=O)c1nn(CC(=O)N2C[C@H](F)C[C@H]2C(=O)N2CCc3c([nH]c4ccccc34)C2)c2ccc(C#Cc3ncccn3)cc12 |
| InChI | InChI=1S/C32H27FN8O3/c33-20-15-27(32(44)39-13-10-22-21-4-1-2-5-24(21)37-25(22)17-39)40(16-20)29(42)18-41-26-8-6-19(7-9-28-35-11-3-12-36-28)14-23(26)30(38-41)31(34)43/h1-6,8,11-12,14,20,27,37H,10,13,15-18H2,(H2,34,43)/t20-,27+/m1/s1 |
| InChIKey | DNRLBUJDCJTNGB-HRFSGMKKSA-N |
| XLogP | 2.33 |
| TPSA | 143.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.62 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|