About 2,2-bis(4-methoxyphenyl)-1,3-dioxolane
2,2-bis(4-methoxyphenyl)-1,3-dioxolane (PubChem CID 118323133) has the molecular formula C17H18O4
and a molecular weight of 286.33 g/mol. Its IUPAC name is 2,2-bis(4-methoxyphenyl)-1,3-dioxolane.
Molecular Properties
| Compound Name | 2,2-bis(4-methoxyphenyl)-1,3-dioxolane |
| PubChem CID | 118323133 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 2,2-bis(4-methoxyphenyl)-1,3-dioxolane |
| SMILES | COc1ccc(C2(c3ccc(OC)cc3)OCCO2)cc1 |
| InChI | InChI=1S/C17H18O4/c1-18-15-7-3-13(4-8-15)17(20-11-12-21-17)14-5-9-16(19-2)10-6-14/h3-10H,11-12H2,1-2H3 |
| InChIKey | AIWGYHHBRPDQLQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,2-bis(4-methoxyphenyl)-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis(4-methoxyphenyl)-1,3-dioxolane?
The IUPAC name of 2,2-bis(4-methoxyphenyl)-1,3-dioxolane (CID 118323133) is 2,2-bis(4-methoxyphenyl)-1,3-dioxolane.
What is the SMILES notation for 2,2-bis(4-methoxyphenyl)-1,3-dioxolane?
The canonical SMILES for 2,2-bis(4-methoxyphenyl)-1,3-dioxolane is COc1ccc(C2(c3ccc(OC)cc3)OCCO2)cc1.
What is the InChIKey of 2,2-bis(4-methoxyphenyl)-1,3-dioxolane?
The InChIKey is AIWGYHHBRPDQLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O4/c1-18-15-7-3-13(4-8-15)17(20-11-12-21-17)14-5-9-16(19-2)10-6-14/h3-10H,11-12H2,1-2H3.
What are the key properties of 2,2-bis(4-methoxyphenyl)-1,3-dioxolane?
2,2-bis(4-methoxyphenyl)-1,3-dioxolane has a molecular weight of 286.33 g/mol, XLogP of 2.95, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(4-methoxyphenyl)-1,3-dioxolane is sourced from PubChem (CID 118323133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).