C35H29Cl2N3O4 — CID 118324098
4-[4-[[6-[bis(4-chlorophenyl)methyl]-2-oxo-1H-quinolin-4-yl]amino]piperidine-1-carbonyl]benzoic acid (PubChem CID 118324098) has the molecular formula C35H29Cl2N3O4 and a molecular weight of 626.54 g/mol. Its IUPAC name is 4-[4-[[6-[bis(4-chlorophenyl)methyl]-2-oxo-1H-quinolin-4-yl]amino]piperidine-1-carbonyl]benzoic acid.
| Compound Name | 4-[4-[[6-[bis(4-chlorophenyl)methyl]-2-oxo-1H-quinolin-4-yl]amino]piperidine-1-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 118324098 |
| Molecular Formula | C35H29Cl2N3O4 |
| Molecular Weight | 626.54 g/mol |
| Exact Mass | 625.15 |
| IUPAC Name | 4-[4-[[6-[bis(4-chlorophenyl)methyl]-2-oxo-1H-quinolin-4-yl]amino]piperidine-1-carbonyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C(=O)N2CCC(Nc3cc(=O)[nH]c4ccc(C(c5ccc(Cl)cc5)c5ccc(Cl)cc5)cc34)CC2)cc1 |
| InChI | InChI=1S/C35H29Cl2N3O4/c36-26-10-5-21(6-11-26)33(22-7-12-27(37)13-8-22)25-9-14-30-29(19-25)31(20-32(41)39-30)38-28-15-17-40(18-16-28)34(42)23-1-3-24(4-2-23)35(43)44/h1-14,19-20,28,33H,15-18H2,(H,43,44)(H2,38,39,41) |
| InChIKey | HLXBZHWWDPFRAD-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.54 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|