C37H41Cl2F3N4O5S — CID 118324144
tert-butyl N-[4-[6-[bis(4-chlorophenyl)methyl]-4-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]amino]quinolin-8-yl]oxybutyl]carbamate (PubChem CID 118324144) has the molecular formula C37H41Cl2F3N4O5S and a molecular weight of 781.72 g/mol. Its IUPAC name is tert-butyl N-[4-[6-[bis(4-chlorophenyl)methyl]-4-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]amino]quinolin-8-yl]oxybutyl]carbamate.
| Compound Name | tert-butyl N-[4-[6-[bis(4-chlorophenyl)methyl]-4-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]amino]quinolin-8-yl]oxybutyl]carbamate |
|---|---|
| PubChem CID | 118324144 |
| Molecular Formula | C37H41Cl2F3N4O5S |
| Molecular Weight | 781.72 g/mol |
| Exact Mass | 780.21 |
| IUPAC Name | tert-butyl N-[4-[6-[bis(4-chlorophenyl)methyl]-4-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]amino]quinolin-8-yl]oxybutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCOc1cc(C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)cc2c(NC3CCN(S(=O)(=O)C(F)(F)F)CC3)ccnc12 |
| InChI | InChI=1S/C37H41Cl2F3N4O5S/c1-36(2,3)51-35(47)44-17-4-5-21-50-32-23-26(33(24-6-10-27(38)11-7-24)25-8-12-28(39)13-9-25)22-30-31(14-18-43-34(30)32)45-29-15-19-46(20-16-29)52(48,49)37(40,41)42/h6-14,18,22-23,29,33H,4-5,15-17,19-21H2,1-3H3,(H,43,45)(H,44,47) |
| InChIKey | ICAJWMGMNOJYPC-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.72 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|