C27H27ClF2N3O8P — CID 118324214
[3-[3-acetyl-1-[2-[(2S,4R)-2-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-4-fluoropyrrolidin-1-yl]-2-oxoethyl]indol-6-yl]oxy-3-oxopropyl]phosphonic acid (PubChem CID 118324214) has the molecular formula C27H27ClF2N3O8P and a molecular weight of 625.95 g/mol. Its IUPAC name is [3-[3-acetyl-1-[2-[(2S,4R)-2-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-4-fluoropyrrolidin-1-yl]-2-oxoethyl]indol-6-yl]oxy-3-oxopropyl]phosphonic acid.
| Compound Name | [3-[3-acetyl-1-[2-[(2S,4R)-2-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-4-fluoropyrrolidin-1-yl]-2-oxoethyl]indol-6-yl]oxy-3-oxopropyl]phosphonic acid |
|---|---|
| PubChem CID | 118324214 |
| Molecular Formula | C27H27ClF2N3O8P |
| Molecular Weight | 625.95 g/mol |
| Exact Mass | 625.12 |
| IUPAC Name | [3-[3-acetyl-1-[2-[(2S,4R)-2-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-4-fluoropyrrolidin-1-yl]-2-oxoethyl]indol-6-yl]oxy-3-oxopropyl]phosphonic acid |
| SMILES | CC(=O)c1cn(CC(=O)N2C[C@H](F)C[C@H]2C(=O)NCc2cccc(Cl)c2F)c2cc(OC(=O)CCP(=O)(O)O)ccc12 |
| InChI | InChI=1S/C27H27ClF2N3O8P/c1-15(34)20-13-32(22-10-18(5-6-19(20)22)41-25(36)7-8-42(38,39)40)14-24(35)33-12-17(29)9-23(33)27(37)31-11-16-3-2-4-21(28)26(16)30/h2-6,10,13,17,23H,7-9,11-12,14H2,1H3,(H,31,37)(H2,38,39,40)/t17-,23+/m1/s1 |
| InChIKey | PAGOJMVYEBYSOC-HXOBKFHXSA-N |
| XLogP | 3.37 |
| TPSA | 155.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.95 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|