About tert-butyl (2S,4R)-2-[(1-acetylindol-3-yl)carbamoyl]-4-fluoropyrrolidine-1-carboxylate
tert-butyl (2S,4R)-2-[(1-acetylindol-3-yl)carbamoyl]-4-fluoropyrrolidine-1-carboxylate (PubChem CID 118324225) has the molecular formula C20H24FN3O4
and a molecular weight of 389.43 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-[(1-acetylindol-3-yl)carbamoyl]-4-fluoropyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2S,4R)-2-[(1-acetylindol-3-yl)carbamoyl]-4-fluoropyrrolidine-1-carboxylate |
| PubChem CID | 118324225 |
| Molecular Formula | C20H24FN3O4 |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | tert-butyl (2S,4R)-2-[(1-acetylindol-3-yl)carbamoyl]-4-fluoropyrrolidine-1-carboxylate |
| SMILES | CC(=O)n1cc(NC(=O)[C@@H]2C[C@@H](F)CN2C(=O)OC(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C20H24FN3O4/c1-12(25)23-11-15(14-7-5-6-8-16(14)23)22-18(26)17-9-13(21)10-24(17)19(27)28-20(2,3)4/h5-8,11,13,17H,9-10H2,1-4H3,(H,22,26)/t13-,17+/m1/s1 |
| InChIKey | OMSZVSQKNMCCCX-DYVFJYSZSA-N |
| XLogP | 3.59 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl (2S,4R)-2-[(1-acetylindol-3-yl)carbamoyl]-4-fluoropyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S,4R)-2-[(1-acetylindol-3-yl)carbamoyl]-4-fluoropyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl (2S,4R)-2-[(1-acetylindol-3-yl)carbamoyl]-4-fluoropyrrolidine-1-carboxylate (CID 118324225) is tert-butyl (2S,4R)-2-[(1-acetylindol-3-yl)carbamoyl]-4-fluoropyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl (2S,4R)-2-[(1-acetylindol-3-yl)carbamoyl]-4-fluoropyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl (2S,4R)-2-[(1-acetylindol-3-yl)carbamoyl]-4-fluoropyrrolidine-1-carboxylate is CC(=O)n1cc(NC(=O)[C@@H]2C[C@@H](F)CN2C(=O)OC(C)(C)C)c2ccccc21.
What is the InChIKey of tert-butyl (2S,4R)-2-[(1-acetylindol-3-yl)carbamoyl]-4-fluoropyrrolidine-1-carboxylate?
The InChIKey is OMSZVSQKNMCCCX-DYVFJYSZSA-N. The full InChI is InChI=1S/C20H24FN3O4/c1-12(25)23-11-15(14-7-5-6-8-16(14)23)22-18(26)17-9-13(21)10-24(17)19(27)28-20(2,3)4/h5-8,11,13,17H,9-10H2,1-4H3,(H,22,26)/t13-,17+/m1/s1.
What are the key properties of tert-butyl (2S,4R)-2-[(1-acetylindol-3-yl)carbamoyl]-4-fluoropyrrolidine-1-carboxylate?
tert-butyl (2S,4R)-2-[(1-acetylindol-3-yl)carbamoyl]-4-fluoropyrrolidine-1-carboxylate has a molecular weight of 389.43 g/mol, XLogP of 3.59, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S,4R)-2-[(1-acetylindol-3-yl)carbamoyl]-4-fluoropyrrolidine-1-carboxylate is sourced from PubChem (CID 118324225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).