C24H28F3N3O3 — CID 118324977
1-[3-[2,2-dimethyl-7-(trifluoromethyl)-3H-1,4-benzoxazin-4-yl]phenyl]-N-(3-hydroxypropyl)azetidine-3-carboxamide (PubChem CID 118324977) has the molecular formula C24H28F3N3O3 and a molecular weight of 463.50 g/mol. Its IUPAC name is 1-[3-[2,2-dimethyl-7-(trifluoromethyl)-3H-1,4-benzoxazin-4-yl]phenyl]-N-(3-hydroxypropyl)azetidine-3-carboxamide.
| Compound Name | 1-[3-[2,2-dimethyl-7-(trifluoromethyl)-3H-1,4-benzoxazin-4-yl]phenyl]-N-(3-hydroxypropyl)azetidine-3-carboxamide |
|---|---|
| PubChem CID | 118324977 |
| Molecular Formula | C24H28F3N3O3 |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 1-[3-[2,2-dimethyl-7-(trifluoromethyl)-3H-1,4-benzoxazin-4-yl]phenyl]-N-(3-hydroxypropyl)azetidine-3-carboxamide |
| SMILES | CC1(C)CN(c2cccc(N3CC(C(=O)NCCCO)C3)c2)c2ccc(C(F)(F)F)cc2O1 |
| InChI | InChI=1S/C24H28F3N3O3/c1-23(2)15-30(20-8-7-17(24(25,26)27)11-21(20)33-23)19-6-3-5-18(12-19)29-13-16(14-29)22(32)28-9-4-10-31/h3,5-8,11-12,16,31H,4,9-10,13-15H2,1-2H3,(H,28,32) |
| InChIKey | XFPXMAMWESUGHG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|