About 2,2-dimethyl-7-propyl-3,4-dihydrochromen-5-ol
2,2-dimethyl-7-propyl-3,4-dihydrochromen-5-ol (PubChem CID 118325055) has the molecular formula C14H20O2
and a molecular weight of 220.31 g/mol. Its IUPAC name is 2,2-dimethyl-7-propyl-3,4-dihydrochromen-5-ol.
Molecular Properties
| Compound Name | 2,2-dimethyl-7-propyl-3,4-dihydrochromen-5-ol |
| PubChem CID | 118325055 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 2,2-dimethyl-7-propyl-3,4-dihydrochromen-5-ol |
| SMILES | CCCc1cc(O)c2c(c1)OC(C)(C)CC2 |
| InChI | InChI=1S/C14H20O2/c1-4-5-10-8-12(15)11-6-7-14(2,3)16-13(11)9-10/h8-9,15H,4-7H2,1-3H3 |
| InChIKey | YVGFJIKWCMZZAS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-dimethyl-7-propyl-3,4-dihydrochromen-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-7-propyl-3,4-dihydrochromen-5-ol?
The IUPAC name of 2,2-dimethyl-7-propyl-3,4-dihydrochromen-5-ol (CID 118325055) is 2,2-dimethyl-7-propyl-3,4-dihydrochromen-5-ol.
What is the SMILES notation for 2,2-dimethyl-7-propyl-3,4-dihydrochromen-5-ol?
The canonical SMILES for 2,2-dimethyl-7-propyl-3,4-dihydrochromen-5-ol is CCCc1cc(O)c2c(c1)OC(C)(C)CC2.
What is the InChIKey of 2,2-dimethyl-7-propyl-3,4-dihydrochromen-5-ol?
The InChIKey is YVGFJIKWCMZZAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O2/c1-4-5-10-8-12(15)11-6-7-14(2,3)16-13(11)9-10/h8-9,15H,4-7H2,1-3H3.
What are the key properties of 2,2-dimethyl-7-propyl-3,4-dihydrochromen-5-ol?
2,2-dimethyl-7-propyl-3,4-dihydrochromen-5-ol has a molecular weight of 220.31 g/mol, XLogP of 3.45, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-7-propyl-3,4-dihydrochromen-5-ol is sourced from PubChem (CID 118325055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).