About 2-(2,4-dioxopentyl)guanidine
2-(2,4-dioxopentyl)guanidine (PubChem CID 118325727) has the molecular formula C6H11N3O2
and a molecular weight of 157.17 g/mol. Its IUPAC name is 2-(2,4-dioxopentyl)guanidine.
Molecular Properties
| Compound Name | 2-(2,4-dioxopentyl)guanidine |
| PubChem CID | 118325727 |
| Molecular Formula | C6H11N3O2 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 2-(2,4-dioxopentyl)guanidine |
| SMILES | CC(=O)CC(=O)CN=C(N)N |
| InChI | InChI=1S/C6H11N3O2/c1-4(10)2-5(11)3-9-6(7)8/h2-3H2,1H3,(H4,7,8,9) |
| InChIKey | FMBLAVIVLGBPQU-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4-dioxopentyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dioxopentyl)guanidine?
The IUPAC name of 2-(2,4-dioxopentyl)guanidine (CID 118325727) is 2-(2,4-dioxopentyl)guanidine.
What is the SMILES notation for 2-(2,4-dioxopentyl)guanidine?
The canonical SMILES for 2-(2,4-dioxopentyl)guanidine is CC(=O)CC(=O)CN=C(N)N.
What is the InChIKey of 2-(2,4-dioxopentyl)guanidine?
The InChIKey is FMBLAVIVLGBPQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O2/c1-4(10)2-5(11)3-9-6(7)8/h2-3H2,1H3,(H4,7,8,9).
What are the key properties of 2-(2,4-dioxopentyl)guanidine?
2-(2,4-dioxopentyl)guanidine has a molecular weight of 157.17 g/mol, XLogP of -1.19, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dioxopentyl)guanidine is sourced from PubChem (CID 118325727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).