C20H34FN4O6P — CID 118325934
[4-[2-[6-(2,6-diaminohexanoylamino)hexylamino]-1-fluoro-2-oxoethyl]phenyl] dihydrogen phosphate (PubChem CID 118325934) has the molecular formula C20H34FN4O6P and a molecular weight of 476.49 g/mol. Its IUPAC name is [4-[2-[6-(2,6-diaminohexanoylamino)hexylamino]-1-fluoro-2-oxoethyl]phenyl] dihydrogen phosphate.
| Compound Name | [4-[2-[6-(2,6-diaminohexanoylamino)hexylamino]-1-fluoro-2-oxoethyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 118325934 |
| Molecular Formula | C20H34FN4O6P |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | [4-[2-[6-(2,6-diaminohexanoylamino)hexylamino]-1-fluoro-2-oxoethyl]phenyl] dihydrogen phosphate |
| SMILES | NCCCCC(N)C(=O)NCCCCCCNC(=O)C(F)c1ccc(OP(=O)(O)O)cc1 |
| InChI | InChI=1S/C20H34FN4O6P/c21-18(15-8-10-16(11-9-15)31-32(28,29)30)20(27)25-14-6-2-1-5-13-24-19(26)17(23)7-3-4-12-22/h8-11,17-18H,1-7,12-14,22-23H2,(H,24,26)(H,25,27)(H2,28,29,30) |
| InChIKey | OLTLUPWOHYHKCI-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 177.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|