C14H13BrFNS — CID 118326615
2-[2-(bromomethyl)-4-fluorophenyl]-4,5,6,7-tetrahydro-1,3-benzothiazole (PubChem CID 118326615) has the molecular formula C14H13BrFNS and a molecular weight of 326.23 g/mol. Its IUPAC name is 2-[2-(bromomethyl)-4-fluorophenyl]-4,5,6,7-tetrahydro-1,3-benzothiazole.
| Compound Name | 2-[2-(bromomethyl)-4-fluorophenyl]-4,5,6,7-tetrahydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 118326615 |
| Molecular Formula | C14H13BrFNS |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 2-[2-(bromomethyl)-4-fluorophenyl]-4,5,6,7-tetrahydro-1,3-benzothiazole |
| SMILES | Fc1ccc(-c2nc3c(s2)CCCC3)c(CBr)c1 |
| InChI | InChI=1S/C14H13BrFNS/c15-8-9-7-10(16)5-6-11(9)14-17-12-3-1-2-4-13(12)18-14/h5-7H,1-4,8H2 |
| InChIKey | CVDJTTBPQABZNG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|