C24H19F3N6O3 — CID 118326821
5,5-dimethyl-2-[2-methyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridin-3-yl]-6-oxo-7H-pyrrolo[2,3-d]pyrimidine-4-carboxamide (PubChem CID 118326821) has the molecular formula C24H19F3N6O3 and a molecular weight of 496.45 g/mol. Its IUPAC name is 5,5-dimethyl-2-[2-methyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridin-3-yl]-6-oxo-7H-pyrrolo[2,3-d]pyrimidine-4-carboxamide.
| Compound Name | 5,5-dimethyl-2-[2-methyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridin-3-yl]-6-oxo-7H-pyrrolo[2,3-d]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 118326821 |
| Molecular Formula | C24H19F3N6O3 |
| Molecular Weight | 496.45 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 5,5-dimethyl-2-[2-methyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridin-3-yl]-6-oxo-7H-pyrrolo[2,3-d]pyrimidine-4-carboxamide |
| SMILES | Cc1nc2c(OCc3c(F)ccc(F)c3F)cccn2c1-c1nc2c(c(C(N)=O)n1)C(C)(C)C(=O)N2 |
| InChI | InChI=1S/C24H19F3N6O3/c1-10-18(21-30-17(19(28)34)15-20(31-21)32-23(35)24(15,2)3)33-8-4-5-14(22(33)29-10)36-9-11-12(25)6-7-13(26)16(11)27/h4-8H,9H2,1-3H3,(H2,28,34)(H,30,31,32,35) |
| InChIKey | HRSHUMJYDNERNI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 124.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|