About [2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-1,3-thiazol-5-yl]methyl formate
[2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-1,3-thiazol-5-yl]methyl formate (PubChem CID 118326945) has the molecular formula C10H9ClN4O2S
and a molecular weight of 284.73 g/mol. Its IUPAC name is [2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-1,3-thiazol-5-yl]methyl formate.
Molecular Properties
| Compound Name | [2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-1,3-thiazol-5-yl]methyl formate |
| PubChem CID | 118326945 |
| Molecular Formula | C10H9ClN4O2S |
| Molecular Weight | 284.73 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | [2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-1,3-thiazol-5-yl]methyl formate |
| SMILES | Cc1nc(Cl)cc(Nc2ncc(COC=O)s2)n1 |
| InChI | InChI=1S/C10H9ClN4O2S/c1-6-13-8(11)2-9(14-6)15-10-12-3-7(18-10)4-17-5-16/h2-3,5H,4H2,1H3,(H,12,13,14,15) |
| InChIKey | GHVRQPSEBYIDMH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.73 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-1,3-thiazol-5-yl]methyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-1,3-thiazol-5-yl]methyl formate?
The IUPAC name of [2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-1,3-thiazol-5-yl]methyl formate (CID 118326945) is [2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-1,3-thiazol-5-yl]methyl formate.
What is the SMILES notation for [2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-1,3-thiazol-5-yl]methyl formate?
The canonical SMILES for [2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-1,3-thiazol-5-yl]methyl formate is Cc1nc(Cl)cc(Nc2ncc(COC=O)s2)n1.
What is the InChIKey of [2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-1,3-thiazol-5-yl]methyl formate?
The InChIKey is GHVRQPSEBYIDMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClN4O2S/c1-6-13-8(11)2-9(14-6)15-10-12-3-7(18-10)4-17-5-16/h2-3,5H,4H2,1H3,(H,12,13,14,15).
What are the key properties of [2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-1,3-thiazol-5-yl]methyl formate?
[2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-1,3-thiazol-5-yl]methyl formate has a molecular weight of 284.73 g/mol, XLogP of 2.31, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-1,3-thiazol-5-yl]methyl formate is sourced from PubChem (CID 118326945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).