C31H44N6O11 — CID 118327055
tert-butyl N-[4-[(5S)-16-nitro-7,10,13-trioxo-11-(3-oxobutyl)-5-(2-oxopropylcarbamoyl)-2-oxa-6,9,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-trien-8-yl]butyl]carbamate (PubChem CID 118327055) has the molecular formula C31H44N6O11 and a molecular weight of 676.72 g/mol. Its IUPAC name is tert-butyl N-[4-[(5S)-16-nitro-7,10,13-trioxo-11-(3-oxobutyl)-5-(2-oxopropylcarbamoyl)-2-oxa-6,9,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-trien-8-yl]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[(5S)-16-nitro-7,10,13-trioxo-11-(3-oxobutyl)-5-(2-oxopropylcarbamoyl)-2-oxa-6,9,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-trien-8-yl]butyl]carbamate |
|---|---|
| PubChem CID | 118327055 |
| Molecular Formula | C31H44N6O11 |
| Molecular Weight | 676.72 g/mol |
| Exact Mass | 676.31 |
| IUPAC Name | tert-butyl N-[4-[(5S)-16-nitro-7,10,13-trioxo-11-(3-oxobutyl)-5-(2-oxopropylcarbamoyl)-2-oxa-6,9,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-trien-8-yl]butyl]carbamate |
| SMILES | CC(=O)CCC1NC(=O)c2cc([N+](=O)[O-])ccc2OCC[C@@H](C(=O)NCC(C)=O)NC(=O)C(CCCCNC(=O)OC(C)(C)C)NC1=O |
| InChI | InChI=1S/C31H44N6O11/c1-18(38)9-11-23-29(43)35-22(8-6-7-14-32-30(44)48-31(3,4)5)28(42)36-24(27(41)33-17-19(2)39)13-15-47-25-12-10-20(37(45)46)16-21(25)26(40)34-23/h10,12,16,22-24H,6-9,11,13-15,17H2,1-5H3,(H,32,44)(H,33,41)(H,34,40)(H,35,43)(H,36,42)/t22?,23?,24-/m0/s1 |
| InChIKey | KKYMAHHDTGJPRZ-VHYCJAOWSA-N |
| XLogP | 1.21 |
| TPSA | 241.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.72 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|