C19H30O3P2 — CID 118327084
(3aR,4S,5R,6aS)-4-[(3R)-3-(diphosphanyloxy)-5-phenylpentyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol (PubChem CID 118327084) has the molecular formula C19H30O3P2 and a molecular weight of 368.39 g/mol. Its IUPAC name is (3aR,4S,5R,6aS)-4-[(3R)-3-(diphosphanyloxy)-5-phenylpentyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol.
| Compound Name | (3aR,4S,5R,6aS)-4-[(3R)-3-(diphosphanyloxy)-5-phenylpentyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
|---|---|
| PubChem CID | 118327084 |
| Molecular Formula | C19H30O3P2 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | (3aR,4S,5R,6aS)-4-[(3R)-3-(diphosphanyloxy)-5-phenylpentyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
| SMILES | C[C@@H]1C[C@@H]2OC(O)C[C@@H]2[C@H]1CC[C@H](CCc1ccccc1)OPP |
| InChI | InChI=1S/C19H30O3P2/c1-13-11-18-17(12-19(20)21-18)16(13)10-9-15(22-24-23)8-7-14-5-3-2-4-6-14/h2-6,13,15-20,24H,7-12,23H2,1H3/t13-,15+,16+,17-,18+,19?/m1/s1 |
| InChIKey | GTQUYXNKYOUPHF-UBKSZCNJSA-N |
| XLogP | 4.55 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|