C12H19N — CID 118327151
(2Z,4Z)-1-cyclopropyl-2-propylhexa-2,4-dien-1-imine (PubChem CID 118327151) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is (2Z,4Z)-1-cyclopropyl-2-propylhexa-2,4-dien-1-imine.
| Compound Name | (2Z,4Z)-1-cyclopropyl-2-propylhexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 118327151 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | (2Z,4Z)-1-cyclopropyl-2-propylhexa-2,4-dien-1-imine |
| SMILES | [H]/N=C(C(=C\C=C/C)/CCC)\C1CC1 |
| InChI | InChI=1S/C12H19N/c1-3-5-7-10(6-4-2)12(13)11-8-9-11/h3,5,7,11,13H,4,6,8-9H2,1-2H3/b5-3-,10-7-,13-12- |
| InChIKey | APLUBVBMXVWLPM-QJPVUFRJSA-N |
| XLogP | 3.72 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|