C12H18ClNO — CID 118327377
4-[(3E,5E)-6-chlorohexa-1,3,5-trien-3-yl]-1-methylpiperidin-4-ol (PubChem CID 118327377) has the molecular formula C12H18ClNO and a molecular weight of 227.74 g/mol. Its IUPAC name is 4-[(3E,5E)-6-chlorohexa-1,3,5-trien-3-yl]-1-methylpiperidin-4-ol.
| Compound Name | 4-[(3E,5E)-6-chlorohexa-1,3,5-trien-3-yl]-1-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 118327377 |
| Molecular Formula | C12H18ClNO |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 4-[(3E,5E)-6-chlorohexa-1,3,5-trien-3-yl]-1-methylpiperidin-4-ol |
| SMILES | C=C/C(=C\C=C\Cl)C1(O)CCN(C)CC1 |
| InChI | InChI=1S/C12H18ClNO/c1-3-11(5-4-8-13)12(15)6-9-14(2)10-7-12/h3-5,8,15H,1,6-7,9-10H2,2H3/b8-4+,11-5+ |
| InChIKey | DKZPKPNPSFQCMC-JNKBEKGTSA-N |
| XLogP | 2.31 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|