C17H26O3 — CID 11832759
(1'S,4'aS,8'aS)-1',4'a-dimethyl-1'-prop-2-enylspiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydronaphthalene]-2'-one (PubChem CID 11832759) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is (1'S,4'aS,8'aS)-1',4'a-dimethyl-1'-prop-2-enylspiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydronaphthalene]-2'-one.
| Compound Name | (1'S,4'aS,8'aS)-1',4'a-dimethyl-1'-prop-2-enylspiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydronaphthalene]-2'-one |
|---|---|
| PubChem CID | 11832759 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (1'S,4'aS,8'aS)-1',4'a-dimethyl-1'-prop-2-enylspiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydronaphthalene]-2'-one |
| SMILES | C=CC[C@]1(C)C(=O)CC[C@@]2(C)[C@H]1CCCC21OCCO1 |
| InChI | InChI=1S/C17H26O3/c1-4-8-15(2)13-6-5-9-17(19-11-12-20-17)16(13,3)10-7-14(15)18/h4,13H,1,5-12H2,2-3H3/t13-,15-,16-/m0/s1 |
| InChIKey | WYUGBCPTNATHFP-BPUTZDHNSA-N |
| XLogP | 3.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|