C30H38N2O14S2 — CID 118327710
(2R,4S,5S,6R)-5-acetamido-2-[3-(2-carboxyethylsulfanyl)propoxy]-6-[(1R,2R)-1,2-dihydroxy-3-[(4-phenylbenzoyl)amino]propyl]-4-sulfooxyoxane-2-carboxylic acid (PubChem CID 118327710) has the molecular formula C30H38N2O14S2 and a molecular weight of 714.77 g/mol. Its IUPAC name is (2R,4S,5S,6R)-5-acetamido-2-[3-(2-carboxyethylsulfanyl)propoxy]-6-[(1R,2R)-1,2-dihydroxy-3-[(4-phenylbenzoyl)amino]propyl]-4-sulfooxyoxane-2-carboxylic acid.
| Compound Name | (2R,4S,5S,6R)-5-acetamido-2-[3-(2-carboxyethylsulfanyl)propoxy]-6-[(1R,2R)-1,2-dihydroxy-3-[(4-phenylbenzoyl)amino]propyl]-4-sulfooxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 118327710 |
| Molecular Formula | C30H38N2O14S2 |
| Molecular Weight | 714.77 g/mol |
| Exact Mass | 714.18 |
| IUPAC Name | (2R,4S,5S,6R)-5-acetamido-2-[3-(2-carboxyethylsulfanyl)propoxy]-6-[(1R,2R)-1,2-dihydroxy-3-[(4-phenylbenzoyl)amino]propyl]-4-sulfooxyoxane-2-carboxylic acid |
| SMILES | CC(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CNC(=O)c2ccc(-c3ccccc3)cc2)O[C@@](OCCCSCCC(=O)O)(C(=O)O)C[C@@H]1OS(=O)(=O)O |
| InChI | InChI=1S/C30H38N2O14S2/c1-18(33)32-25-23(46-48(41,42)43)16-30(29(39)40,44-13-5-14-47-15-12-24(35)36)45-27(25)26(37)22(34)17-31-28(38)21-10-8-20(9-11-21)19-6-3-2-4-7-19/h2-4,6-11,22-23,25-27,34,37H,5,12-17H2,1H3,(H,31,38)(H,32,33)(H,35,36)(H,39,40)(H,41,42,43)/t22-,23+,25-,26-,27-,30-/m1/s1 |
| InChIKey | DGUPUEDEAJPDOQ-PSDUUTKLSA-N |
| XLogP | 0.68 |
| TPSA | 255.32 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.77 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|