About 1-chloro-2-[(2R)-2,3-dihydroxypropyl]guanidine
1-chloro-2-[(2R)-2,3-dihydroxypropyl]guanidine (PubChem CID 118327824) has the molecular formula C4H10ClN3O2
and a molecular weight of 167.60 g/mol. Its IUPAC name is 1-chloro-2-[(2R)-2,3-dihydroxypropyl]guanidine.
Molecular Properties
| Compound Name | 1-chloro-2-[(2R)-2,3-dihydroxypropyl]guanidine |
| PubChem CID | 118327824 |
| Molecular Formula | C4H10ClN3O2 |
| Molecular Weight | 167.60 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | 1-chloro-2-[(2R)-2,3-dihydroxypropyl]guanidine |
| SMILES | N/C(=N\C[C@@H](O)CO)NCl |
| InChI | InChI=1S/C4H10ClN3O2/c5-8-4(6)7-1-3(10)2-9/h3,9-10H,1-2H2,(H3,6,7,8)/t3-/m1/s1 |
| InChIKey | GCCNFMRRHWFEBB-GSVOUGTGSA-N |
| XLogP | -1.60 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.60 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-2-[(2R)-2,3-dihydroxypropyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-[(2R)-2,3-dihydroxypropyl]guanidine?
The IUPAC name of 1-chloro-2-[(2R)-2,3-dihydroxypropyl]guanidine (CID 118327824) is 1-chloro-2-[(2R)-2,3-dihydroxypropyl]guanidine.
What is the SMILES notation for 1-chloro-2-[(2R)-2,3-dihydroxypropyl]guanidine?
The canonical SMILES for 1-chloro-2-[(2R)-2,3-dihydroxypropyl]guanidine is N/C(=N\C[C@@H](O)CO)NCl.
What is the InChIKey of 1-chloro-2-[(2R)-2,3-dihydroxypropyl]guanidine?
The InChIKey is GCCNFMRRHWFEBB-GSVOUGTGSA-N. The full InChI is InChI=1S/C4H10ClN3O2/c5-8-4(6)7-1-3(10)2-9/h3,9-10H,1-2H2,(H3,6,7,8)/t3-/m1/s1.
What are the key properties of 1-chloro-2-[(2R)-2,3-dihydroxypropyl]guanidine?
1-chloro-2-[(2R)-2,3-dihydroxypropyl]guanidine has a molecular weight of 167.60 g/mol, XLogP of -1.60, 3 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-[(2R)-2,3-dihydroxypropyl]guanidine is sourced from PubChem (CID 118327824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).