About 3-tert-butyl-4-(3,3-dimethylbut-1-ynyl)naphthalen-2-amine
3-tert-butyl-4-(3,3-dimethylbut-1-ynyl)naphthalen-2-amine (PubChem CID 11832794) has the molecular formula C20H25N
and a molecular weight of 279.43 g/mol. Its IUPAC name is 3-tert-butyl-4-(3,3-dimethylbut-1-ynyl)naphthalen-2-amine.
Molecular Properties
| Compound Name | 3-tert-butyl-4-(3,3-dimethylbut-1-ynyl)naphthalen-2-amine |
| PubChem CID | 11832794 |
| Molecular Formula | C20H25N |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 3-tert-butyl-4-(3,3-dimethylbut-1-ynyl)naphthalen-2-amine |
| SMILES | CC(C)(C)C#Cc1c(C(C)(C)C)c(N)cc2ccccc12 |
| InChI | InChI=1S/C20H25N/c1-19(2,3)12-11-16-15-10-8-7-9-14(15)13-17(21)18(16)20(4,5)6/h7-10,13H,21H2,1-6H3 |
| InChIKey | QCIQGMLZSBCJTQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-tert-butyl-4-(3,3-dimethylbut-1-ynyl)naphthalen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-4-(3,3-dimethylbut-1-ynyl)naphthalen-2-amine?
The IUPAC name of 3-tert-butyl-4-(3,3-dimethylbut-1-ynyl)naphthalen-2-amine (CID 11832794) is 3-tert-butyl-4-(3,3-dimethylbut-1-ynyl)naphthalen-2-amine.
What is the SMILES notation for 3-tert-butyl-4-(3,3-dimethylbut-1-ynyl)naphthalen-2-amine?
The canonical SMILES for 3-tert-butyl-4-(3,3-dimethylbut-1-ynyl)naphthalen-2-amine is CC(C)(C)C#Cc1c(C(C)(C)C)c(N)cc2ccccc12.
What is the InChIKey of 3-tert-butyl-4-(3,3-dimethylbut-1-ynyl)naphthalen-2-amine?
The InChIKey is QCIQGMLZSBCJTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N/c1-19(2,3)12-11-16-15-10-8-7-9-14(15)13-17(21)18(16)20(4,5)6/h7-10,13H,21H2,1-6H3.
What are the key properties of 3-tert-butyl-4-(3,3-dimethylbut-1-ynyl)naphthalen-2-amine?
3-tert-butyl-4-(3,3-dimethylbut-1-ynyl)naphthalen-2-amine has a molecular weight of 279.43 g/mol, XLogP of 5.12, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-4-(3,3-dimethylbut-1-ynyl)naphthalen-2-amine is sourced from PubChem (CID 11832794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).