About 1-phenyl-N,N-bis(trimethylsilylmethyl)methanamine
1-phenyl-N,N-bis(trimethylsilylmethyl)methanamine (PubChem CID 11832796) has the molecular formula C15H29NSi2
and a molecular weight of 279.58 g/mol. Its IUPAC name is 1-phenyl-N,N-bis(trimethylsilylmethyl)methanamine.
Molecular Properties
| Compound Name | 1-phenyl-N,N-bis(trimethylsilylmethyl)methanamine |
| PubChem CID | 11832796 |
| Molecular Formula | C15H29NSi2 |
| Molecular Weight | 279.58 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 1-phenyl-N,N-bis(trimethylsilylmethyl)methanamine |
| SMILES | C[Si](C)(C)CN(Cc1ccccc1)C[Si](C)(C)C |
| InChI | InChI=1S/C15H29NSi2/c1-17(2,3)13-16(14-18(4,5)6)12-15-10-8-7-9-11-15/h7-11H,12-14H2,1-6H3 |
| InChIKey | BPSRTBHGLKFZDK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.58 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-phenyl-N,N-bis(trimethylsilylmethyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-N,N-bis(trimethylsilylmethyl)methanamine?
The IUPAC name of 1-phenyl-N,N-bis(trimethylsilylmethyl)methanamine (CID 11832796) is 1-phenyl-N,N-bis(trimethylsilylmethyl)methanamine.
What is the SMILES notation for 1-phenyl-N,N-bis(trimethylsilylmethyl)methanamine?
The canonical SMILES for 1-phenyl-N,N-bis(trimethylsilylmethyl)methanamine is C[Si](C)(C)CN(Cc1ccccc1)C[Si](C)(C)C.
What is the InChIKey of 1-phenyl-N,N-bis(trimethylsilylmethyl)methanamine?
The InChIKey is BPSRTBHGLKFZDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29NSi2/c1-17(2,3)13-16(14-18(4,5)6)12-15-10-8-7-9-11-15/h7-11H,12-14H2,1-6H3.
What are the key properties of 1-phenyl-N,N-bis(trimethylsilylmethyl)methanamine?
1-phenyl-N,N-bis(trimethylsilylmethyl)methanamine has a molecular weight of 279.58 g/mol, XLogP of 4.24, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-N,N-bis(trimethylsilylmethyl)methanamine is sourced from PubChem (CID 11832796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).