About 4-(4-fluoro-1,4-dimethylpiperidin-1-ium-1-yl)-2-methylbutan-2-amine
4-(4-fluoro-1,4-dimethylpiperidin-1-ium-1-yl)-2-methylbutan-2-amine (PubChem CID 118328090) has the molecular formula C12H26FN2+
and a molecular weight of 217.35 g/mol. Its IUPAC name is 4-(4-fluoro-1,4-dimethylpiperidin-1-ium-1-yl)-2-methylbutan-2-amine.
Molecular Properties
| Compound Name | 4-(4-fluoro-1,4-dimethylpiperidin-1-ium-1-yl)-2-methylbutan-2-amine |
| PubChem CID | 118328090 |
| Molecular Formula | C12H26FN2+ |
| Molecular Weight | 217.35 g/mol |
| Exact Mass | 217.21 |
| IUPAC Name | 4-(4-fluoro-1,4-dimethylpiperidin-1-ium-1-yl)-2-methylbutan-2-amine |
| SMILES | CC(C)(N)CC[N+]1(C)CCC(C)(F)CC1 |
| InChI | InChI=1S/C12H26FN2/c1-11(2,14)5-8-15(4)9-6-12(3,13)7-10-15/h5-10,14H2,1-4H3/q+1 |
| InChIKey | MWKRXZZLAHORLC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-fluoro-1,4-dimethylpiperidin-1-ium-1-yl)-2-methylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-fluoro-1,4-dimethylpiperidin-1-ium-1-yl)-2-methylbutan-2-amine?
The IUPAC name of 4-(4-fluoro-1,4-dimethylpiperidin-1-ium-1-yl)-2-methylbutan-2-amine (CID 118328090) is 4-(4-fluoro-1,4-dimethylpiperidin-1-ium-1-yl)-2-methylbutan-2-amine.
What is the SMILES notation for 4-(4-fluoro-1,4-dimethylpiperidin-1-ium-1-yl)-2-methylbutan-2-amine?
The canonical SMILES for 4-(4-fluoro-1,4-dimethylpiperidin-1-ium-1-yl)-2-methylbutan-2-amine is CC(C)(N)CC[N+]1(C)CCC(C)(F)CC1.
What is the InChIKey of 4-(4-fluoro-1,4-dimethylpiperidin-1-ium-1-yl)-2-methylbutan-2-amine?
The InChIKey is MWKRXZZLAHORLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26FN2/c1-11(2,14)5-8-15(4)9-6-12(3,13)7-10-15/h5-10,14H2,1-4H3/q+1.
What are the key properties of 4-(4-fluoro-1,4-dimethylpiperidin-1-ium-1-yl)-2-methylbutan-2-amine?
4-(4-fluoro-1,4-dimethylpiperidin-1-ium-1-yl)-2-methylbutan-2-amine has a molecular weight of 217.35 g/mol, XLogP of 2.08, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-fluoro-1,4-dimethylpiperidin-1-ium-1-yl)-2-methylbutan-2-amine is sourced from PubChem (CID 118328090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).