C10H21F3N+ — CID 118328091
3,3-dimethylbutyl-dimethyl-(2,2,2-trifluoroethyl)azanium (PubChem CID 118328091) has the molecular formula C10H21F3N+ and a molecular weight of 212.28 g/mol. Its IUPAC name is 3,3-dimethylbutyl-dimethyl-(2,2,2-trifluoroethyl)azanium.
| Compound Name | 3,3-dimethylbutyl-dimethyl-(2,2,2-trifluoroethyl)azanium |
|---|---|
| PubChem CID | 118328091 |
| Molecular Formula | C10H21F3N+ |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 3,3-dimethylbutyl-dimethyl-(2,2,2-trifluoroethyl)azanium |
| SMILES | CC(C)(C)CC[N+](C)(C)CC(F)(F)F |
| InChI | InChI=1S/C10H21F3N/c1-9(2,3)6-7-14(4,5)8-10(11,12)13/h6-8H2,1-5H3/q+1 |
| InChIKey | WCWZBPIMXWLUIS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|