About 1-(4,4-dimethylpentyl)-3-fluoro-3-methylpyrrolidine
1-(4,4-dimethylpentyl)-3-fluoro-3-methylpyrrolidine (PubChem CID 118328439) has the molecular formula C12H24FN
and a molecular weight of 201.33 g/mol. Its IUPAC name is 1-(4,4-dimethylpentyl)-3-fluoro-3-methylpyrrolidine.
Molecular Properties
| Compound Name | 1-(4,4-dimethylpentyl)-3-fluoro-3-methylpyrrolidine |
| PubChem CID | 118328439 |
| Molecular Formula | C12H24FN |
| Molecular Weight | 201.33 g/mol |
| Exact Mass | 201.19 |
| IUPAC Name | 1-(4,4-dimethylpentyl)-3-fluoro-3-methylpyrrolidine |
| SMILES | CC(C)(C)CCCN1CCC(C)(F)C1 |
| InChI | InChI=1S/C12H24FN/c1-11(2,3)6-5-8-14-9-7-12(4,13)10-14/h5-10H2,1-4H3 |
| InChIKey | AHLNTPDHYUUONG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(4,4-dimethylpentyl)-3-fluoro-3-methylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,4-dimethylpentyl)-3-fluoro-3-methylpyrrolidine?
The IUPAC name of 1-(4,4-dimethylpentyl)-3-fluoro-3-methylpyrrolidine (CID 118328439) is 1-(4,4-dimethylpentyl)-3-fluoro-3-methylpyrrolidine.
What is the SMILES notation for 1-(4,4-dimethylpentyl)-3-fluoro-3-methylpyrrolidine?
The canonical SMILES for 1-(4,4-dimethylpentyl)-3-fluoro-3-methylpyrrolidine is CC(C)(C)CCCN1CCC(C)(F)C1.
What is the InChIKey of 1-(4,4-dimethylpentyl)-3-fluoro-3-methylpyrrolidine?
The InChIKey is AHLNTPDHYUUONG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24FN/c1-11(2,3)6-5-8-14-9-7-12(4,13)10-14/h5-10H2,1-4H3.
What are the key properties of 1-(4,4-dimethylpentyl)-3-fluoro-3-methylpyrrolidine?
1-(4,4-dimethylpentyl)-3-fluoro-3-methylpyrrolidine has a molecular weight of 201.33 g/mol, XLogP of 3.25, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,4-dimethylpentyl)-3-fluoro-3-methylpyrrolidine is sourced from PubChem (CID 118328439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).