C24H16F3N5O3 — CID 118328983
9-[6-(hydroxymethyl)-3-pyridinyl]-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione (PubChem CID 118328983) has the molecular formula C24H16F3N5O3 and a molecular weight of 479.42 g/mol. Its IUPAC name is 9-[6-(hydroxymethyl)-3-pyridinyl]-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione.
| Compound Name | 9-[6-(hydroxymethyl)-3-pyridinyl]-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 118328983 |
| Molecular Formula | C24H16F3N5O3 |
| Molecular Weight | 479.42 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | 9-[6-(hydroxymethyl)-3-pyridinyl]-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
| SMILES | Cn1c(=O)c2cnc3ccc(-c4ccc(CO)nc4)nc3c2n(-c2cccc(C(F)(F)F)c2)c1=O |
| InChI | InChI=1S/C24H16F3N5O3/c1-31-22(34)17-11-29-19-8-7-18(13-5-6-15(12-33)28-10-13)30-20(19)21(17)32(23(31)35)16-4-2-3-14(9-16)24(25,26)27/h2-11,33H,12H2,1H3 |
| InChIKey | GVPSLMMVIQXHRY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|