C30H22F3N7O2 — CID 118328992
1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]-9-quinolin-3-ylpyrimido[5,4-c][1,5]naphthyridine-2,4-dione (PubChem CID 118328992) has the molecular formula C30H22F3N7O2 and a molecular weight of 569.55 g/mol. Its IUPAC name is 1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]-9-quinolin-3-ylpyrimido[5,4-c][1,5]naphthyridine-2,4-dione.
| Compound Name | 1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]-9-quinolin-3-ylpyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 118328992 |
| Molecular Formula | C30H22F3N7O2 |
| Molecular Weight | 569.55 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | 1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]-9-quinolin-3-ylpyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(-c2ccc(N3CCNCC3)c(C(F)(F)F)c2)c2c1cnc1ccc(-c3cnc4ccccc4c3)nc12 |
| InChI | InChI=1S/C30H22F3N7O2/c31-30(32,33)21-14-19(5-8-25(21)39-11-9-34-10-12-39)40-27-20(28(41)38-29(40)42)16-36-24-7-6-23(37-26(24)27)18-13-17-3-1-2-4-22(17)35-15-18/h1-8,13-16,34H,9-12H2,(H,38,41,42) |
| InChIKey | GCWKVGIMDWFGGQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 108.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|