C10H4Br2N2O — CID 118329879
5,11-dibromo-8-oxa-3,12-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene (PubChem CID 118329879) has the molecular formula C10H4Br2N2O and a molecular weight of 327.96 g/mol. Its IUPAC name is 5,11-dibromo-8-oxa-3,12-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene.
| Compound Name | 5,11-dibromo-8-oxa-3,12-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene |
|---|---|
| PubChem CID | 118329879 |
| Molecular Formula | C10H4Br2N2O |
| Molecular Weight | 327.96 g/mol |
| Exact Mass | 325.87 |
| IUPAC Name | 5,11-dibromo-8-oxa-3,12-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene |
| SMILES | Brc1cnc2c(c1)oc1cc(Br)ncc12 |
| InChI | InChI=1S/C10H4Br2N2O/c11-5-1-8-10(14-3-5)6-4-13-9(12)2-7(6)15-8/h1-4H |
| InChIKey | FACPRPJETWLUCL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.96 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|