C31H29Cl2F3N4O4S — CID 118329994
2-[6-[bis(4-chlorophenyl)methyl]-4-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]amino]quinolin-2-yl]oxy-N-methylacetamide (PubChem CID 118329994) has the molecular formula C31H29Cl2F3N4O4S and a molecular weight of 681.56 g/mol. Its IUPAC name is 2-[6-[bis(4-chlorophenyl)methyl]-4-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]amino]quinolin-2-yl]oxy-N-methylacetamide.
| Compound Name | 2-[6-[bis(4-chlorophenyl)methyl]-4-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]amino]quinolin-2-yl]oxy-N-methylacetamide |
|---|---|
| PubChem CID | 118329994 |
| Molecular Formula | C31H29Cl2F3N4O4S |
| Molecular Weight | 681.56 g/mol |
| Exact Mass | 680.12 |
| IUPAC Name | 2-[6-[bis(4-chlorophenyl)methyl]-4-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]amino]quinolin-2-yl]oxy-N-methylacetamide |
| SMILES | CNC(=O)COc1cc(NC2CCN(S(=O)(=O)C(F)(F)F)CC2)c2cc(C(c3ccc(Cl)cc3)c3ccc(Cl)cc3)ccc2n1 |
| InChI | InChI=1S/C31H29Cl2F3N4O4S/c1-37-28(41)18-44-29-17-27(38-24-12-14-40(15-13-24)45(42,43)31(34,35)36)25-16-21(6-11-26(25)39-29)30(19-2-7-22(32)8-3-19)20-4-9-23(33)10-5-20/h2-11,16-17,24,30H,12-15,18H2,1H3,(H,37,41)(H,38,39) |
| InChIKey | OGYGVHGXLQFQDQ-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.56 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|