C15H26O5 — CID 11833018
(3S,3aR,5R,8S,8aS)-3,8-dihydroxy-8-(hydroxymethyl)-5-(2-hydroxypropan-2-yl)-3-methyl-3a,4,5,6,7,8a-hexahydro-1H-azulen-2-one (PubChem CID 11833018) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is (3S,3aR,5R,8S,8aS)-3,8-dihydroxy-8-(hydroxymethyl)-5-(2-hydroxypropan-2-yl)-3-methyl-3a,4,5,6,7,8a-hexahydro-1H-azulen-2-one.
| Compound Name | (3S,3aR,5R,8S,8aS)-3,8-dihydroxy-8-(hydroxymethyl)-5-(2-hydroxypropan-2-yl)-3-methyl-3a,4,5,6,7,8a-hexahydro-1H-azulen-2-one |
|---|---|
| PubChem CID | 11833018 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | (3S,3aR,5R,8S,8aS)-3,8-dihydroxy-8-(hydroxymethyl)-5-(2-hydroxypropan-2-yl)-3-methyl-3a,4,5,6,7,8a-hexahydro-1H-azulen-2-one |
| SMILES | CC(C)(O)[C@@H]1CC[C@@](O)(CO)[C@H]2CC(=O)[C@@](C)(O)[C@@H]2C1 |
| InChI | InChI=1S/C15H26O5/c1-13(2,18)9-4-5-15(20,8-16)11-7-12(17)14(3,19)10(11)6-9/h9-11,16,18-20H,4-8H2,1-3H3/t9-,10-,11+,14+,15-/m1/s1 |
| InChIKey | OOOHHEYUUOCWGG-HFLGISGGSA-N |
| XLogP | 0.24 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |