C27H28ClFN4O4 — CID 118330300
1-[2-[(2S,3aR,7aR)-2-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2-oxoethyl]-6-hydroxyindole-3-carboxamide (PubChem CID 118330300) has the molecular formula C27H28ClFN4O4 and a molecular weight of 527.00 g/mol. Its IUPAC name is 1-[2-[(2S,3aR,7aR)-2-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2-oxoethyl]-6-hydroxyindole-3-carboxamide.
| Compound Name | 1-[2-[(2S,3aR,7aR)-2-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2-oxoethyl]-6-hydroxyindole-3-carboxamide |
|---|---|
| PubChem CID | 118330300 |
| Molecular Formula | C27H28ClFN4O4 |
| Molecular Weight | 527.00 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | 1-[2-[(2S,3aR,7aR)-2-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2-oxoethyl]-6-hydroxyindole-3-carboxamide |
| SMILES | NC(=O)c1cn(CC(=O)N2[C@@H]3CCCC[C@@H]3C[C@H]2C(=O)NCc2cccc(Cl)c2F)c2cc(O)ccc12 |
| InChI | InChI=1S/C27H28ClFN4O4/c28-20-6-3-5-16(25(20)29)12-31-27(37)23-10-15-4-1-2-7-21(15)33(23)24(35)14-32-13-19(26(30)36)18-9-8-17(34)11-22(18)32/h3,5-6,8-9,11,13,15,21,23,34H,1-2,4,7,10,12,14H2,(H2,30,36)(H,31,37)/t15-,21-,23+/m1/s1 |
| InChIKey | WBUJRODUMFYHJF-AECOYVPUSA-N |
| XLogP | 3.71 |
| TPSA | 117.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.00 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |