C13H23NO6 — CID 11833099
tert-butyl (3aR,4S,6aR)-6-hydroxy-4-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazole-3-carboxylate (PubChem CID 11833099) has the molecular formula C13H23NO6 and a molecular weight of 289.33 g/mol. Its IUPAC name is tert-butyl (3aR,4S,6aR)-6-hydroxy-4-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazole-3-carboxylate.
| Compound Name | tert-butyl (3aR,4S,6aR)-6-hydroxy-4-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazole-3-carboxylate |
|---|---|
| PubChem CID | 11833099 |
| Molecular Formula | C13H23NO6 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | tert-butyl (3aR,4S,6aR)-6-hydroxy-4-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazole-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2[C@@H](CO)OC(O)[C@@H]2OC1(C)C |
| InChI | InChI=1S/C13H23NO6/c1-12(2,3)20-11(17)14-8-7(6-15)18-10(16)9(8)19-13(14,4)5/h7-10,15-16H,6H2,1-5H3/t7-,8-,9-,10?/m1/s1 |
| InChIKey | ZAOPMKRZBFEZDH-PBVVMKELSA-N |
| XLogP | 0.44 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |