C16H12ClF3N2O2 — CID 118331427
1-[3-[6-chloro-5-(trifluoromethyl)-3-pyridinyl]phenyl]azetidine-3-carboxylic acid (PubChem CID 118331427) has the molecular formula C16H12ClF3N2O2 and a molecular weight of 356.73 g/mol. Its IUPAC name is 1-[3-[6-chloro-5-(trifluoromethyl)-3-pyridinyl]phenyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[3-[6-chloro-5-(trifluoromethyl)-3-pyridinyl]phenyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 118331427 |
| Molecular Formula | C16H12ClF3N2O2 |
| Molecular Weight | 356.73 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 1-[3-[6-chloro-5-(trifluoromethyl)-3-pyridinyl]phenyl]azetidine-3-carboxylic acid |
| SMILES | O=C(O)C1CN(c2cccc(-c3cnc(Cl)c(C(F)(F)F)c3)c2)C1 |
| InChI | InChI=1S/C16H12ClF3N2O2/c17-14-13(16(18,19)20)5-10(6-21-14)9-2-1-3-12(4-9)22-7-11(8-22)15(23)24/h1-6,11H,7-8H2,(H,23,24) |
| InChIKey | ATMLDLFNCIJGGN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.73 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|