C13H21N — CID 118331752
(7E)-2-ethenyl-7-ethylidene-6-propyl-1,2,3,6-tetrahydroazepine (PubChem CID 118331752) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is (7E)-2-ethenyl-7-ethylidene-6-propyl-1,2,3,6-tetrahydroazepine.
| Compound Name | (7E)-2-ethenyl-7-ethylidene-6-propyl-1,2,3,6-tetrahydroazepine |
|---|---|
| PubChem CID | 118331752 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | (7E)-2-ethenyl-7-ethylidene-6-propyl-1,2,3,6-tetrahydroazepine |
| SMILES | C=CC1CC=CC(CCC)/C(=C\C)N1 |
| InChI | InChI=1S/C13H21N/c1-4-8-11-9-7-10-12(5-2)14-13(11)6-3/h5-7,9,11-12,14H,2,4,8,10H2,1,3H3/b13-6+ |
| InChIKey | QCEJGIZRWORSGH-AWNIVKPZSA-N |
| XLogP | 3.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|