C45H27N5 — CID 118332356
4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-8-phenylbenzo[k]phenanthridin-6-yl]benzonitrile (PubChem CID 118332356) has the molecular formula C45H27N5 and a molecular weight of 637.75 g/mol. Its IUPAC name is 4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-8-phenylbenzo[k]phenanthridin-6-yl]benzonitrile.
| Compound Name | 4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-8-phenylbenzo[k]phenanthridin-6-yl]benzonitrile |
|---|---|
| PubChem CID | 118332356 |
| Molecular Formula | C45H27N5 |
| Molecular Weight | 637.75 g/mol |
| Exact Mass | 637.23 |
| IUPAC Name | 4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-8-phenylbenzo[k]phenanthridin-6-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2nc3cc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)ccc3c3c2cc(-c2ccccc2)c2ccccc23)cc1 |
| InChI | InChI=1S/C45H27N5/c46-28-29-20-22-31(23-21-29)42-39-27-38(30-12-4-1-5-13-30)35-18-10-11-19-36(35)41(39)37-25-24-34(26-40(37)47-42)45-49-43(32-14-6-2-7-15-32)48-44(50-45)33-16-8-3-9-17-33/h1-27H |
| InChIKey | MGVMEIOLODVRQY-UHFFFAOYSA-N |
| XLogP | 10.93 |
| TPSA | 75.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.75 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|