About 2,5-ditert-butyl-3,4-dihydropyrazole
2,5-ditert-butyl-3,4-dihydropyrazole (PubChem CID 118332592) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is 2,5-ditert-butyl-3,4-dihydropyrazole.
Molecular Properties
| Compound Name | 2,5-ditert-butyl-3,4-dihydropyrazole |
| PubChem CID | 118332592 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 2,5-ditert-butyl-3,4-dihydropyrazole |
| SMILES | CC(C)(C)C1=NN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C11H22N2/c1-10(2,3)9-7-8-13(12-9)11(4,5)6/h7-8H2,1-6H3 |
| InChIKey | VOCQEOHGBNHEPP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-ditert-butyl-3,4-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-ditert-butyl-3,4-dihydropyrazole?
The IUPAC name of 2,5-ditert-butyl-3,4-dihydropyrazole (CID 118332592) is 2,5-ditert-butyl-3,4-dihydropyrazole.
What is the SMILES notation for 2,5-ditert-butyl-3,4-dihydropyrazole?
The canonical SMILES for 2,5-ditert-butyl-3,4-dihydropyrazole is CC(C)(C)C1=NN(C(C)(C)C)CC1.
What is the InChIKey of 2,5-ditert-butyl-3,4-dihydropyrazole?
The InChIKey is VOCQEOHGBNHEPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2/c1-10(2,3)9-7-8-13(12-9)11(4,5)6/h7-8H2,1-6H3.
What are the key properties of 2,5-ditert-butyl-3,4-dihydropyrazole?
2,5-ditert-butyl-3,4-dihydropyrazole has a molecular weight of 182.31 g/mol, XLogP of 2.89, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-ditert-butyl-3,4-dihydropyrazole is sourced from PubChem (CID 118332592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).