About 5-(1,1-difluoroethyl)-1,3-dimethylpyrimidine-2,4-dione
5-(1,1-difluoroethyl)-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 118332950) has the molecular formula C8H10F2N2O2
and a molecular weight of 204.18 g/mol. Its IUPAC name is 5-(1,1-difluoroethyl)-1,3-dimethylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5-(1,1-difluoroethyl)-1,3-dimethylpyrimidine-2,4-dione |
| PubChem CID | 118332950 |
| Molecular Formula | C8H10F2N2O2 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 5-(1,1-difluoroethyl)-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | Cn1cc(C(C)(F)F)c(=O)n(C)c1=O |
| InChI | InChI=1S/C8H10F2N2O2/c1-8(9,10)5-4-11(2)7(14)12(3)6(5)13/h4H,1-3H3 |
| InChIKey | UGNCRESLQRJTBZ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(1,1-difluoroethyl)-1,3-dimethylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,1-difluoroethyl)-1,3-dimethylpyrimidine-2,4-dione?
The IUPAC name of 5-(1,1-difluoroethyl)-1,3-dimethylpyrimidine-2,4-dione (CID 118332950) is 5-(1,1-difluoroethyl)-1,3-dimethylpyrimidine-2,4-dione.
What is the SMILES notation for 5-(1,1-difluoroethyl)-1,3-dimethylpyrimidine-2,4-dione?
The canonical SMILES for 5-(1,1-difluoroethyl)-1,3-dimethylpyrimidine-2,4-dione is Cn1cc(C(C)(F)F)c(=O)n(C)c1=O.
What is the InChIKey of 5-(1,1-difluoroethyl)-1,3-dimethylpyrimidine-2,4-dione?
The InChIKey is UGNCRESLQRJTBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F2N2O2/c1-8(9,10)5-4-11(2)7(14)12(3)6(5)13/h4H,1-3H3.
What are the key properties of 5-(1,1-difluoroethyl)-1,3-dimethylpyrimidine-2,4-dione?
5-(1,1-difluoroethyl)-1,3-dimethylpyrimidine-2,4-dione has a molecular weight of 204.18 g/mol, XLogP of 0.20, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,1-difluoroethyl)-1,3-dimethylpyrimidine-2,4-dione is sourced from PubChem (CID 118332950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).