About (6Z)-6-(hydroxymethylimino)-2,7-dimethyloctan-3-one
(6Z)-6-(hydroxymethylimino)-2,7-dimethyloctan-3-one (PubChem CID 118332963) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is (6Z)-6-(hydroxymethylimino)-2,7-dimethyloctan-3-one.
Molecular Properties
| Compound Name | (6Z)-6-(hydroxymethylimino)-2,7-dimethyloctan-3-one |
| PubChem CID | 118332963 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | (6Z)-6-(hydroxymethylimino)-2,7-dimethyloctan-3-one |
| SMILES | CC(C)C(=O)CC/C(=N/CO)C(C)C |
| InChI | InChI=1S/C11H21NO2/c1-8(2)10(12-7-13)5-6-11(14)9(3)4/h8-9,13H,5-7H2,1-4H3/b12-10- |
| InChIKey | NGMXQQAQXCZGAD-BENRWUELSA-N |
| XLogP | 2.04 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (6Z)-6-(hydroxymethylimino)-2,7-dimethyloctan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z)-6-(hydroxymethylimino)-2,7-dimethyloctan-3-one?
The IUPAC name of (6Z)-6-(hydroxymethylimino)-2,7-dimethyloctan-3-one (CID 118332963) is (6Z)-6-(hydroxymethylimino)-2,7-dimethyloctan-3-one.
What is the SMILES notation for (6Z)-6-(hydroxymethylimino)-2,7-dimethyloctan-3-one?
The canonical SMILES for (6Z)-6-(hydroxymethylimino)-2,7-dimethyloctan-3-one is CC(C)C(=O)CC/C(=N/CO)C(C)C.
What is the InChIKey of (6Z)-6-(hydroxymethylimino)-2,7-dimethyloctan-3-one?
The InChIKey is NGMXQQAQXCZGAD-BENRWUELSA-N. The full InChI is InChI=1S/C11H21NO2/c1-8(2)10(12-7-13)5-6-11(14)9(3)4/h8-9,13H,5-7H2,1-4H3/b12-10-.
What are the key properties of (6Z)-6-(hydroxymethylimino)-2,7-dimethyloctan-3-one?
(6Z)-6-(hydroxymethylimino)-2,7-dimethyloctan-3-one has a molecular weight of 199.29 g/mol, XLogP of 2.04, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z)-6-(hydroxymethylimino)-2,7-dimethyloctan-3-one is sourced from PubChem (CID 118332963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).