C23H30N4O6S — CID 118334859
(2S,4S)-2-benzyl-4-hydroxy-5-[(4-nitrophenyl)sulfonylamino]-N-piperidin-1-ylpentanamide (PubChem CID 118334859) has the molecular formula C23H30N4O6S and a molecular weight of 490.58 g/mol. Its IUPAC name is (2S,4S)-2-benzyl-4-hydroxy-5-[(4-nitrophenyl)sulfonylamino]-N-piperidin-1-ylpentanamide.
| Compound Name | (2S,4S)-2-benzyl-4-hydroxy-5-[(4-nitrophenyl)sulfonylamino]-N-piperidin-1-ylpentanamide |
|---|---|
| PubChem CID | 118334859 |
| Molecular Formula | C23H30N4O6S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | (2S,4S)-2-benzyl-4-hydroxy-5-[(4-nitrophenyl)sulfonylamino]-N-piperidin-1-ylpentanamide |
| SMILES | O=C(NN1CCCCC1)[C@@H](Cc1ccccc1)C[C@H](O)CNS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H30N4O6S/c28-21(17-24-34(32,33)22-11-9-20(10-12-22)27(30)31)16-19(15-18-7-3-1-4-8-18)23(29)25-26-13-5-2-6-14-26/h1,3-4,7-12,19,21,24,28H,2,5-6,13-17H2,(H,25,29)/t19-,21-/m0/s1 |
| InChIKey | IERDGVXEBPANNQ-FPOVZHCZSA-N |
| XLogP | 2.00 |
| TPSA | 141.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|