C17H22N6O — CID 118334961
4-N-butyl-5-[(3-methoxy-2-pyridinyl)methyl]pyrrolo[3,2-d]pyrimidine-2,4-diamine (PubChem CID 118334961) has the molecular formula C17H22N6O and a molecular weight of 326.40 g/mol. Its IUPAC name is 4-N-butyl-5-[(3-methoxy-2-pyridinyl)methyl]pyrrolo[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-butyl-5-[(3-methoxy-2-pyridinyl)methyl]pyrrolo[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 118334961 |
| Molecular Formula | C17H22N6O |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 4-N-butyl-5-[(3-methoxy-2-pyridinyl)methyl]pyrrolo[3,2-d]pyrimidine-2,4-diamine |
| SMILES | CCCCNc1nc(N)nc2ccn(Cc3ncccc3OC)c12 |
| InChI | InChI=1S/C17H22N6O/c1-3-4-8-20-16-15-12(21-17(18)22-16)7-10-23(15)11-13-14(24-2)6-5-9-19-13/h5-7,9-10H,3-4,8,11H2,1-2H3,(H3,18,20,21,22) |
| InChIKey | CWPXZGJFGZADAR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|