C14H18N6S — CID 118334964
4-N-butyl-5-(1,3-thiazol-2-ylmethyl)pyrrolo[3,2-d]pyrimidine-2,4-diamine (PubChem CID 118334964) has the molecular formula C14H18N6S and a molecular weight of 302.41 g/mol. Its IUPAC name is 4-N-butyl-5-(1,3-thiazol-2-ylmethyl)pyrrolo[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-butyl-5-(1,3-thiazol-2-ylmethyl)pyrrolo[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 118334964 |
| Molecular Formula | C14H18N6S |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 4-N-butyl-5-(1,3-thiazol-2-ylmethyl)pyrrolo[3,2-d]pyrimidine-2,4-diamine |
| SMILES | CCCCNc1nc(N)nc2ccn(Cc3nccs3)c12 |
| InChI | InChI=1S/C14H18N6S/c1-2-3-5-17-13-12-10(18-14(15)19-13)4-7-20(12)9-11-16-6-8-21-11/h4,6-8H,2-3,5,9H2,1H3,(H3,15,17,18,19) |
| InChIKey | UFKYDGDJFQKPTF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|