C16H20N6O — CID 118335006
4-N-(2-ethoxyethyl)-5-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidine-2,4-diamine (PubChem CID 118335006) has the molecular formula C16H20N6O and a molecular weight of 312.38 g/mol. Its IUPAC name is 4-N-(2-ethoxyethyl)-5-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(2-ethoxyethyl)-5-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 118335006 |
| Molecular Formula | C16H20N6O |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 4-N-(2-ethoxyethyl)-5-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidine-2,4-diamine |
| SMILES | CCOCCNc1nc(N)nc2ccn(Cc3ccccn3)c12 |
| InChI | InChI=1S/C16H20N6O/c1-2-23-10-8-19-15-14-13(20-16(17)21-15)6-9-22(14)11-12-5-3-4-7-18-12/h3-7,9H,2,8,10-11H2,1H3,(H3,17,19,20,21) |
| InChIKey | OJCFSAPWIPCTQS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|