About 7-but-2-ynylcinnoline
7-but-2-ynylcinnoline (PubChem CID 118335717) has the molecular formula C12H10N2
and a molecular weight of 182.23 g/mol. Its IUPAC name is 7-but-2-ynylcinnoline.
Molecular Properties
| Compound Name | 7-but-2-ynylcinnoline |
| PubChem CID | 118335717 |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 7-but-2-ynylcinnoline |
| SMILES | CC#CCc1ccc2ccnnc2c1 |
| InChI | InChI=1S/C12H10N2/c1-2-3-4-10-5-6-11-7-8-13-14-12(11)9-10/h5-9H,4H2,1H3 |
| InChIKey | UALRZTMCRRKBDW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-but-2-ynylcinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-but-2-ynylcinnoline?
The IUPAC name of 7-but-2-ynylcinnoline (CID 118335717) is 7-but-2-ynylcinnoline.
What is the SMILES notation for 7-but-2-ynylcinnoline?
The canonical SMILES for 7-but-2-ynylcinnoline is CC#CCc1ccc2ccnnc2c1.
What is the InChIKey of 7-but-2-ynylcinnoline?
The InChIKey is UALRZTMCRRKBDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2/c1-2-3-4-10-5-6-11-7-8-13-14-12(11)9-10/h5-9H,4H2,1H3.
What are the key properties of 7-but-2-ynylcinnoline?
7-but-2-ynylcinnoline has a molecular weight of 182.23 g/mol, XLogP of 2.20, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-but-2-ynylcinnoline is sourced from PubChem (CID 118335717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).