C17H27N3O5S2 — CID 118335941
S-[3-[3-(3-acetylsulfanylpropyl)-5-butyl-2,4,6-trioxo-1,3,5-triazinan-1-yl]propyl] ethanethioate (PubChem CID 118335941) has the molecular formula C17H27N3O5S2 and a molecular weight of 417.55 g/mol. Its IUPAC name is S-[3-[3-(3-acetylsulfanylpropyl)-5-butyl-2,4,6-trioxo-1,3,5-triazinan-1-yl]propyl] ethanethioate.
| Compound Name | S-[3-[3-(3-acetylsulfanylpropyl)-5-butyl-2,4,6-trioxo-1,3,5-triazinan-1-yl]propyl] ethanethioate |
|---|---|
| PubChem CID | 118335941 |
| Molecular Formula | C17H27N3O5S2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | S-[3-[3-(3-acetylsulfanylpropyl)-5-butyl-2,4,6-trioxo-1,3,5-triazinan-1-yl]propyl] ethanethioate |
| SMILES | CCCCn1c(=O)n(CCCSC(C)=O)c(=O)n(CCCSC(C)=O)c1=O |
| InChI | InChI=1S/C17H27N3O5S2/c1-4-5-8-18-15(23)19(9-6-11-26-13(2)21)17(25)20(16(18)24)10-7-12-27-14(3)22/h4-12H2,1-3H3 |
| InChIKey | AFZHXXIEVOFDJX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|