C15H30O4S — CID 118336367
(3S,4S,5R)-2-methoxy-3,4-dipropoxy-5-(propoxymethyl)thiolane (PubChem CID 118336367) has the molecular formula C15H30O4S and a molecular weight of 306.47 g/mol. Its IUPAC name is (3S,4S,5R)-2-methoxy-3,4-dipropoxy-5-(propoxymethyl)thiolane.
| Compound Name | (3S,4S,5R)-2-methoxy-3,4-dipropoxy-5-(propoxymethyl)thiolane |
|---|---|
| PubChem CID | 118336367 |
| Molecular Formula | C15H30O4S |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | (3S,4S,5R)-2-methoxy-3,4-dipropoxy-5-(propoxymethyl)thiolane |
| SMILES | CCCOC[C@H]1SC(OC)[C@@H](OCCC)[C@@H]1OCCC |
| InChI | InChI=1S/C15H30O4S/c1-5-8-17-11-12-13(18-9-6-2)14(19-10-7-3)15(16-4)20-12/h12-15H,5-11H2,1-4H3/t12-,13-,14+,15?/m1/s1 |
| InChIKey | YFPOCTGWXLDBPY-JKXDFHQYSA-N |
| XLogP | 3.09 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|