About [(3R,4S,5R)-3-fluoro-4-methoxy-5-(methoxymethyl)thiolan-2-yl] acetate
[(3R,4S,5R)-3-fluoro-4-methoxy-5-(methoxymethyl)thiolan-2-yl] acetate (PubChem CID 118336410) has the molecular formula C9H15FO4S
and a molecular weight of 238.28 g/mol. Its IUPAC name is [(3R,4S,5R)-3-fluoro-4-methoxy-5-(methoxymethyl)thiolan-2-yl] acetate.
Molecular Properties
| Compound Name | [(3R,4S,5R)-3-fluoro-4-methoxy-5-(methoxymethyl)thiolan-2-yl] acetate |
| PubChem CID | 118336410 |
| Molecular Formula | C9H15FO4S |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | [(3R,4S,5R)-3-fluoro-4-methoxy-5-(methoxymethyl)thiolan-2-yl] acetate |
| SMILES | COC[C@H]1SC(OC(C)=O)[C@H](F)[C@@H]1OC |
| InChI | InChI=1S/C9H15FO4S/c1-5(11)14-9-7(10)8(13-3)6(15-9)4-12-2/h6-9H,4H2,1-3H3/t6-,7-,8-,9?/m1/s1 |
| InChIKey | ICNVYSPOOYGRBX-BYBOBHAWSA-N |
| XLogP | 0.99 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(3R,4S,5R)-3-fluoro-4-methoxy-5-(methoxymethyl)thiolan-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4S,5R)-3-fluoro-4-methoxy-5-(methoxymethyl)thiolan-2-yl] acetate?
The IUPAC name of [(3R,4S,5R)-3-fluoro-4-methoxy-5-(methoxymethyl)thiolan-2-yl] acetate (CID 118336410) is [(3R,4S,5R)-3-fluoro-4-methoxy-5-(methoxymethyl)thiolan-2-yl] acetate.
What is the SMILES notation for [(3R,4S,5R)-3-fluoro-4-methoxy-5-(methoxymethyl)thiolan-2-yl] acetate?
The canonical SMILES for [(3R,4S,5R)-3-fluoro-4-methoxy-5-(methoxymethyl)thiolan-2-yl] acetate is COC[C@H]1SC(OC(C)=O)[C@H](F)[C@@H]1OC.
What is the InChIKey of [(3R,4S,5R)-3-fluoro-4-methoxy-5-(methoxymethyl)thiolan-2-yl] acetate?
The InChIKey is ICNVYSPOOYGRBX-BYBOBHAWSA-N. The full InChI is InChI=1S/C9H15FO4S/c1-5(11)14-9-7(10)8(13-3)6(15-9)4-12-2/h6-9H,4H2,1-3H3/t6-,7-,8-,9?/m1/s1.
What are the key properties of [(3R,4S,5R)-3-fluoro-4-methoxy-5-(methoxymethyl)thiolan-2-yl] acetate?
[(3R,4S,5R)-3-fluoro-4-methoxy-5-(methoxymethyl)thiolan-2-yl] acetate has a molecular weight of 238.28 g/mol, XLogP of 0.99, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4S,5R)-3-fluoro-4-methoxy-5-(methoxymethyl)thiolan-2-yl] acetate is sourced from PubChem (CID 118336410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).