C24H18F3N5O4 — CID 118336493
5,5-dimethyl-2-[2-methyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridin-3-yl]-6-oxo-7H-pyrrolo[2,3-d]pyrimidine-4-carboxylic acid (PubChem CID 118336493) has the molecular formula C24H18F3N5O4 and a molecular weight of 497.43 g/mol. Its IUPAC name is 5,5-dimethyl-2-[2-methyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridin-3-yl]-6-oxo-7H-pyrrolo[2,3-d]pyrimidine-4-carboxylic acid.
| Compound Name | 5,5-dimethyl-2-[2-methyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridin-3-yl]-6-oxo-7H-pyrrolo[2,3-d]pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 118336493 |
| Molecular Formula | C24H18F3N5O4 |
| Molecular Weight | 497.43 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | 5,5-dimethyl-2-[2-methyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridin-3-yl]-6-oxo-7H-pyrrolo[2,3-d]pyrimidine-4-carboxylic acid |
| SMILES | Cc1nc2c(OCc3c(F)ccc(F)c3F)cccn2c1-c1nc2c(c(C(=O)O)n1)C(C)(C)C(=O)N2 |
| InChI | InChI=1S/C24H18F3N5O4/c1-10-18(20-29-17(22(33)34)15-19(30-20)31-23(35)24(15,2)3)32-8-4-5-14(21(32)28-10)36-9-11-12(25)6-7-13(26)16(11)27/h4-8H,9H2,1-3H3,(H,33,34)(H,29,30,31,35) |
| InChIKey | MVYLGEKSKITZPX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 118.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|